C23H18Cl3N3O2S2 — CID 69444393
N-[2-[[4,5-bis(4-chlorophenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-4-chlorobenzenesulfonamide (PubChem CID 69444393) has the molecular formula C23H18Cl3N3O2S2 and a molecular weight of 538.91 g/mol. Its IUPAC name is N-[2-[[4,5-bis(4-chlorophenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[2-[[4,5-bis(4-chlorophenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 69444393 |
| Molecular Formula | C23H18Cl3N3O2S2 |
| Molecular Weight | 538.91 g/mol |
| Exact Mass | 536.99 |
| IUPAC Name | N-[2-[[4,5-bis(4-chlorophenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCSc1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18Cl3N3O2S2/c24-17-5-1-15(2-6-17)21-22(16-3-7-18(25)8-4-16)29-23(28-21)32-14-13-27-33(30,31)20-11-9-19(26)10-12-20/h1-12,27H,13-14H2,(H,28,29) |
| InChIKey | VPUNOEWZIBWUNQ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.91 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|