C25H23ClN2O3S — CID 5082570
N-[2-[[2-(4-chlorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-2,4-dimethoxybenzamide (PubChem CID 5082570) has the molecular formula C25H23ClN2O3S and a molecular weight of 466.99 g/mol. Its IUPAC name is N-[2-[[2-(4-chlorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[2-[[2-(4-chlorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 5082570 |
| Molecular Formula | C25H23ClN2O3S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-[2-[[2-(4-chlorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCSc2c(-c3ccc(Cl)cc3)[nH]c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C25H23ClN2O3S/c1-30-18-11-12-20(22(15-18)31-2)25(29)27-13-14-32-24-19-5-3-4-6-21(19)28-23(24)16-7-9-17(26)10-8-16/h3-12,15,28H,13-14H2,1-2H3,(H,27,29) |
| InChIKey | IFDMIEXJFOPWAR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|