C24H20BrClN2O2S — CID 3513264
N-[2-[[2-(4-bromophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-5-chloro-2-methoxybenzamide (PubChem CID 3513264) has the molecular formula C24H20BrClN2O2S and a molecular weight of 515.86 g/mol. Its IUPAC name is N-[2-[[2-(4-bromophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-5-chloro-2-methoxybenzamide.
| Compound Name | N-[2-[[2-(4-bromophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-5-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 3513264 |
| Molecular Formula | C24H20BrClN2O2S |
| Molecular Weight | 515.86 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | N-[2-[[2-(4-bromophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-5-chloro-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCSc1c(-c2ccc(Br)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C24H20BrClN2O2S/c1-30-21-11-10-17(26)14-19(21)24(29)27-12-13-31-23-18-4-2-3-5-20(18)28-22(23)15-6-8-16(25)9-7-15/h2-11,14,28H,12-13H2,1H3,(H,27,29) |
| InChIKey | ORMDPLUPYUKDGD-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.86 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|