C24H21ClN2O2S — CID 4090408
5-chloro-2-methoxy-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide (PubChem CID 4090408) has the molecular formula C24H21ClN2O2S and a molecular weight of 436.96 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 4090408 |
| Molecular Formula | C24H21ClN2O2S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 5-chloro-2-methoxy-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCSc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C24H21ClN2O2S/c1-29-21-12-11-17(25)15-19(21)24(28)26-13-14-30-23-18-9-5-6-10-20(18)27-22(23)16-7-3-2-4-8-16/h2-12,15,27H,13-14H2,1H3,(H,26,28) |
| InChIKey | JFFIRBRUZOIGDD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|