C23H19IN2OS — CID 4139803
2-iodo-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide (PubChem CID 4139803) has the molecular formula C23H19IN2OS and a molecular weight of 498.39 g/mol. Its IUPAC name is 2-iodo-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide.
| Compound Name | 2-iodo-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 4139803 |
| Molecular Formula | C23H19IN2OS |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | 2-iodo-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSc1c(-c2ccccc2)[nH]c2ccccc12)c1ccccc1I |
| InChI | InChI=1S/C23H19IN2OS/c24-19-12-6-4-10-17(19)23(27)25-14-15-28-22-18-11-5-7-13-20(18)26-21(22)16-8-2-1-3-9-16/h1-13,26H,14-15H2,(H,25,27) |
| InChIKey | KQWKPUPUGFTZHM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|