C24H21FN2OS — CID 4282547
3-fluoro-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide (PubChem CID 4282547) has the molecular formula C24H21FN2OS and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 4282547 |
| Molecular Formula | C24H21FN2OS |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3-fluoro-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide |
| SMILES | Cc1ccc(-c2[nH]c3ccccc3c2SCCNC(=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C24H21FN2OS/c1-16-9-11-17(12-10-16)22-23(20-7-2-3-8-21(20)27-22)29-14-13-26-24(28)18-5-4-6-19(25)15-18/h2-12,15,27H,13-14H2,1H3,(H,26,28) |
| InChIKey | FWFVMWYHKYERKD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|