C25H23FN2OS — CID 5183642
2-(4-fluorophenyl)-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]acetamide (PubChem CID 5183642) has the molecular formula C25H23FN2OS and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 5183642 |
| Molecular Formula | C25H23FN2OS |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]acetamide |
| SMILES | Cc1ccc(-c2[nH]c3ccccc3c2SCCNC(=O)Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H23FN2OS/c1-17-6-10-19(11-7-17)24-25(21-4-2-3-5-22(21)28-24)30-15-14-27-23(29)16-18-8-12-20(26)13-9-18/h2-13,28H,14-16H2,1H3,(H,27,29) |
| InChIKey | STJZBKQGEJXNTN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|