C29H25FN2O2S — CID 3468049
2-ethoxy-N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]naphthalene-1-carboxamide (PubChem CID 3468049) has the molecular formula C29H25FN2O2S and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-ethoxy-N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]naphthalene-1-carboxamide.
| Compound Name | 2-ethoxy-N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3468049 |
| Molecular Formula | C29H25FN2O2S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-ethoxy-N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]naphthalene-1-carboxamide |
| SMILES | CCOc1ccc2ccccc2c1C(=O)NCCSc1c(-c2ccc(F)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C29H25FN2O2S/c1-2-34-25-16-13-19-7-3-4-8-22(19)26(25)29(33)31-17-18-35-28-23-9-5-6-10-24(23)32-27(28)20-11-14-21(30)15-12-20/h3-16,32H,2,17-18H2,1H3,(H,31,33) |
| InChIKey | FCMYSPBSHACWGI-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|