C26H26N2O2S — CID 3336028
2-(4-ethoxyphenyl)-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 3336028) has the molecular formula C26H26N2O2S and a molecular weight of 430.57 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 3336028 |
| Molecular Formula | C26H26N2O2S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | CCOc1ccc(CC(=O)NCCSc2c(-c3ccccc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C26H26N2O2S/c1-2-30-21-14-12-19(13-15-21)18-24(29)27-16-17-31-26-22-10-6-7-11-23(22)28-25(26)20-8-4-3-5-9-20/h3-15,28H,2,16-18H2,1H3,(H,27,29) |
| InChIKey | VNEYXNJFERBORP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|