C29H24N2OS — CID 2156509
4-phenyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide (PubChem CID 2156509) has the molecular formula C29H24N2OS and a molecular weight of 448.59 g/mol. Its IUPAC name is 4-phenyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide.
| Compound Name | 4-phenyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 2156509 |
| Molecular Formula | C29H24N2OS |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-phenyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSc1c(-c2ccccc2)[nH]c2ccccc12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24N2OS/c32-29(24-17-15-22(16-18-24)21-9-3-1-4-10-21)30-19-20-33-28-25-13-7-8-14-26(25)31-27(28)23-11-5-2-6-12-23/h1-18,31H,19-20H2,(H,30,32) |
| InChIKey | OVFZCQWPNYZJHS-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|