C25H23N3O3S — CID 4168782
4-methyl-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3-nitrobenzamide (PubChem CID 4168782) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 4-methyl-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3-nitrobenzamide.
| Compound Name | 4-methyl-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 4168782 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-methyl-N-[2-[[2-(4-methylphenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3-nitrobenzamide |
| SMILES | Cc1ccc(-c2[nH]c3ccccc3c2SCCNC(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H23N3O3S/c1-16-7-10-18(11-8-16)23-24(20-5-3-4-6-21(20)27-23)32-14-13-26-25(29)19-12-9-17(2)22(15-19)28(30)31/h3-12,15,27H,13-14H2,1-2H3,(H,26,29) |
| InChIKey | ABEZDJSQHFCVCD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|