C25H22N2O4S — CID 2156545
N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 2156545) has the molecular formula C25H22N2O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 2156545 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccc(-c2[nH]c3ccccc3c2SCCNC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C25H22N2O4S/c1-29-18-9-6-16(7-10-18)23-24(19-4-2-3-5-20(19)27-23)32-13-12-26-25(28)17-8-11-21-22(14-17)31-15-30-21/h2-11,14,27H,12-13,15H2,1H3,(H,26,28) |
| InChIKey | FHPFNNGMGUVWSK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|