C28H31N3O4S2 — CID 2156549
4-(diethylsulfamoyl)-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide (PubChem CID 2156549) has the molecular formula C28H31N3O4S2 and a molecular weight of 537.71 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 2156549 |
| Molecular Formula | C28H31N3O4S2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCCSc2c(-c3ccc(OC)cc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H31N3O4S2/c1-4-31(5-2)37(33,34)23-16-12-21(13-17-23)28(32)29-18-19-36-27-24-8-6-7-9-25(24)30-26(27)20-10-14-22(35-3)15-11-20/h6-17,30H,4-5,18-19H2,1-3H3,(H,29,32) |
| InChIKey | LVYWQDSRXIQSHE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|