C28H30N2O3S — CID 4054289
4-butoxy-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide (PubChem CID 4054289) has the molecular formula C28H30N2O3S and a molecular weight of 474.63 g/mol. Its IUPAC name is 4-butoxy-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 4054289 |
| Molecular Formula | C28H30N2O3S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 4-butoxy-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCCSc2c(-c3ccc(OC)cc3)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H30N2O3S/c1-3-4-18-33-23-15-11-21(12-16-23)28(31)29-17-19-34-27-24-7-5-6-8-25(24)30-26(27)20-9-13-22(32-2)14-10-20/h5-16,30H,3-4,17-19H2,1-2H3,(H,29,31) |
| InChIKey | PNUGXZHAOKWVJP-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|