C27H28N2O4S — CID 2156544
2-(3,4-dimethoxyphenyl)-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]acetamide (PubChem CID 2156544) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 2156544 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]acetamide |
| SMILES | COc1ccc(-c2[nH]c3ccccc3c2SCCNC(=O)Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H28N2O4S/c1-31-20-11-9-19(10-12-20)26-27(21-6-4-5-7-22(21)29-26)34-15-14-28-25(30)17-18-8-13-23(32-2)24(16-18)33-3/h4-13,16,29H,14-15,17H2,1-3H3,(H,28,30) |
| InChIKey | JTLSKSBMRVHJQZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|