C24H28N2O2S — CID 5093284
N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]cyclohexanecarboxamide (PubChem CID 5093284) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 5093284 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[2-[[2-(4-methoxyphenyl)-1H-indol-3-yl]sulfanyl]ethyl]cyclohexanecarboxamide |
| SMILES | COc1ccc(-c2[nH]c3ccccc3c2SCCNC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H28N2O2S/c1-28-19-13-11-17(12-14-19)22-23(20-9-5-6-10-21(20)26-22)29-16-15-25-24(27)18-7-3-2-4-8-18/h5-6,9-14,18,26H,2-4,7-8,15-16H2,1H3,(H,25,27) |
| InChIKey | HZGXGBRPMZOBEF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|