C30H26N2OS — CID 4079247
2,2-diphenyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 4079247) has the molecular formula C30H26N2OS and a molecular weight of 462.62 g/mol. Its IUPAC name is 2,2-diphenyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 4079247 |
| Molecular Formula | C30H26N2OS |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2,2-diphenyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | O=C(NCCSc1c(-c2ccccc2)[nH]c2ccccc12)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H26N2OS/c33-30(27(22-12-4-1-5-13-22)23-14-6-2-7-15-23)31-20-21-34-29-25-18-10-11-19-26(25)32-28(29)24-16-8-3-9-17-24/h1-19,27,32H,20-21H2,(H,31,33) |
| InChIKey | FJPSLKJEBBWWHR-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|