C27H27N3O4S2 — CID 2156516
4-morpholin-4-ylsulfonyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide (PubChem CID 2156516) has the molecular formula C27H27N3O4S2 and a molecular weight of 521.66 g/mol. Its IUPAC name is 4-morpholin-4-ylsulfonyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide.
| Compound Name | 4-morpholin-4-ylsulfonyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 2156516 |
| Molecular Formula | C27H27N3O4S2 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 4-morpholin-4-ylsulfonyl-N-[2-[(2-phenyl-1H-indol-3-yl)sulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSc1c(-c2ccccc2)[nH]c2ccccc12)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H27N3O4S2/c31-27(21-10-12-22(13-11-21)36(32,33)30-15-17-34-18-16-30)28-14-19-35-26-23-8-4-5-9-24(23)29-25(26)20-6-2-1-3-7-20/h1-13,29H,14-19H2,(H,28,31) |
| InChIKey | AFKWOUUBJZYNNI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|