C24H21BrN2OS — CID 3348721
N-[2-[[2-(4-bromophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3-methylbenzamide (PubChem CID 3348721) has the molecular formula C24H21BrN2OS and a molecular weight of 465.42 g/mol. Its IUPAC name is N-[2-[[2-(4-bromophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3-methylbenzamide.
| Compound Name | N-[2-[[2-(4-bromophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 3348721 |
| Molecular Formula | C24H21BrN2OS |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-[2-[[2-(4-bromophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCCSc2c(-c3ccc(Br)cc3)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C24H21BrN2OS/c1-16-5-4-6-18(15-16)24(28)26-13-14-29-23-20-7-2-3-8-21(20)27-22(23)17-9-11-19(25)12-10-17/h2-12,15,27H,13-14H2,1H3,(H,26,28) |
| InChIKey | XQXANUOYDSDZSA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|