C27H21ClFN3O2S — CID 3281972
3-(2-chlorophenyl)-N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 3281972) has the molecular formula C27H21ClFN3O2S and a molecular weight of 506.00 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3281972 |
| Molecular Formula | C27H21ClFN3O2S |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[2-[[2-(4-fluorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2Cl)c1C(=O)NCCSc1c(-c2ccc(F)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C27H21ClFN3O2S/c1-16-23(25(32-34-16)19-6-2-4-8-21(19)28)27(33)30-14-15-35-26-20-7-3-5-9-22(20)31-24(26)17-10-12-18(29)13-11-17/h2-13,31H,14-15H2,1H3,(H,30,33) |
| InChIKey | PGVCHHUNFKJWLC-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|