C28H23ClN2O2S — CID 4610166
N-[2-[[2-(4-chlorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-2-naphthalen-2-yloxyacetamide (PubChem CID 4610166) has the molecular formula C28H23ClN2O2S and a molecular weight of 487.02 g/mol. Its IUPAC name is N-[2-[[2-(4-chlorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[2-[[2-(4-chlorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 4610166 |
| Molecular Formula | C28H23ClN2O2S |
| Molecular Weight | 487.02 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-[2-[[2-(4-chlorophenyl)-1H-indol-3-yl]sulfanyl]ethyl]-2-naphthalen-2-yloxyacetamide |
| SMILES | O=C(COc1ccc2ccccc2c1)NCCSc1c(-c2ccc(Cl)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C28H23ClN2O2S/c29-22-12-9-20(10-13-22)27-28(24-7-3-4-8-25(24)31-27)34-16-15-30-26(32)18-33-23-14-11-19-5-1-2-6-21(19)17-23/h1-14,17,31H,15-16,18H2,(H,30,32) |
| InChIKey | BKEUMTHURROIIX-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.02 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|