C19H18Cl2N2O2S — CID 2156468
2-(2,4-dichlorophenoxy)-N-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 2156468) has the molecular formula C19H18Cl2N2O2S and a molecular weight of 409.34 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 2156468 |
| Molecular Formula | C19H18Cl2N2O2S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-[(2-methyl-1H-indol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | Cc1[nH]c2ccccc2c1SCCNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O2S/c1-12-19(14-4-2-3-5-16(14)23-12)26-9-8-22-18(24)11-25-17-7-6-13(20)10-15(17)21/h2-7,10,23H,8-9,11H2,1H3,(H,22,24) |
| InChIKey | CNJKRJBWMXRBMH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|