C27H36N4O — CID 10432968
N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)amino]pentyl]heptanamide (PubChem CID 10432968) has the molecular formula C27H36N4O and a molecular weight of 432.61 g/mol. Its IUPAC name is N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)amino]pentyl]heptanamide.
| Compound Name | N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)amino]pentyl]heptanamide |
|---|---|
| PubChem CID | 10432968 |
| Molecular Formula | C27H36N4O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | N-[5-[(4,5-diphenyl-1H-imidazol-2-yl)amino]pentyl]heptanamide |
| SMILES | CCCCCCC(=O)NCCCCCNc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C27H36N4O/c1-2-3-4-12-19-24(32)28-20-13-7-14-21-29-27-30-25(22-15-8-5-9-16-22)26(31-27)23-17-10-6-11-18-23/h5-6,8-11,15-18H,2-4,7,12-14,19-21H2,1H3,(H,28,32)(H2,29,30,31) |
| InChIKey | UHZPGFGBMDPWHU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|