C22H42N4OS — CID 139637751
[10-[(4,5-dipropyl-1H-imidazol-2-yl)sulfanyl]-5-ethyldecyl]urea (PubChem CID 139637751) has the molecular formula C22H42N4OS and a molecular weight of 410.67 g/mol. Its IUPAC name is [10-[(4,5-dipropyl-1H-imidazol-2-yl)sulfanyl]-5-ethyldecyl]urea.
| Compound Name | [10-[(4,5-dipropyl-1H-imidazol-2-yl)sulfanyl]-5-ethyldecyl]urea |
|---|---|
| PubChem CID | 139637751 |
| Molecular Formula | C22H42N4OS |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | [10-[(4,5-dipropyl-1H-imidazol-2-yl)sulfanyl]-5-ethyldecyl]urea |
| SMILES | CCCc1nc(SCCCCCC(CC)CCCCNC(N)=O)[nH]c1CCC |
| InChI | InChI=1S/C22H42N4OS/c1-4-12-19-20(13-5-2)26-22(25-19)28-17-11-7-8-14-18(6-3)15-9-10-16-24-21(23)27/h18H,4-17H2,1-3H3,(H,25,26)(H3,23,24,27) |
| InChIKey | KKPRMTSQPCNPED-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|