About 4-methylhexylurea
4-methylhexylurea (PubChem CID 59582725) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is 4-methylhexylurea.
Molecular Properties
| Compound Name | 4-methylhexylurea |
| PubChem CID | 59582725 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 4-methylhexylurea |
| SMILES | CCC(C)CCCNC(N)=O |
| InChI | InChI=1S/C8H18N2O/c1-3-7(2)5-4-6-10-8(9)11/h7H,3-6H2,1-2H3,(H3,9,10,11) |
| InChIKey | MGGWPCLBMHVMJC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methylhexylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylhexylurea?
The IUPAC name of 4-methylhexylurea (CID 59582725) is 4-methylhexylurea.
What is the SMILES notation for 4-methylhexylurea?
The canonical SMILES for 4-methylhexylurea is CCC(C)CCCNC(N)=O.
What is the InChIKey of 4-methylhexylurea?
The InChIKey is MGGWPCLBMHVMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-3-7(2)5-4-6-10-8(9)11/h7H,3-6H2,1-2H3,(H3,9,10,11).
What are the key properties of 4-methylhexylurea?
4-methylhexylurea has a molecular weight of 158.25 g/mol, XLogP of 1.48, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylhexylurea is sourced from PubChem (CID 59582725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).