C8H18ClN3O3 — CID 74933713
ethyl 2-amino-5-(carbamoylamino)pentanoate;hydrochloride (PubChem CID 74933713) has the molecular formula C8H18ClN3O3 and a molecular weight of 239.70 g/mol. Its IUPAC name is ethyl 2-amino-5-(carbamoylamino)pentanoate;hydrochloride.
| Compound Name | ethyl 2-amino-5-(carbamoylamino)pentanoate;hydrochloride |
|---|---|
| PubChem CID | 74933713 |
| Molecular Formula | C8H18ClN3O3 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | ethyl 2-amino-5-(carbamoylamino)pentanoate;hydrochloride |
| SMILES | CCOC(=O)C(N)CCCNC(N)=O.Cl |
| InChI | InChI=1S/C8H17N3O3.ClH/c1-2-14-7(12)6(9)4-3-5-11-8(10)13;/h6H,2-5,9H2,1H3,(H3,10,11,13);1H |
| InChIKey | YGVWAVDBHSVUFL-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|