C10H20N4O5 — CID 90823194
(2S)-3-[(2S)-2-amino-5-(carbamoylamino)pentanoyl]oxy-2-(methylamino)propanoic acid (PubChem CID 90823194) has the molecular formula C10H20N4O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (2S)-3-[(2S)-2-amino-5-(carbamoylamino)pentanoyl]oxy-2-(methylamino)propanoic acid.
| Compound Name | (2S)-3-[(2S)-2-amino-5-(carbamoylamino)pentanoyl]oxy-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 90823194 |
| Molecular Formula | C10H20N4O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (2S)-3-[(2S)-2-amino-5-(carbamoylamino)pentanoyl]oxy-2-(methylamino)propanoic acid |
| SMILES | CN[C@@H](COC(=O)[C@@H](N)CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H20N4O5/c1-13-7(8(15)16)5-19-9(17)6(11)3-2-4-14-10(12)18/h6-7,13H,2-5,11H2,1H3,(H,15,16)(H3,12,14,18)/t6-,7-/m0/s1 |
| InChIKey | PQNNICIZIFUSHJ-BQBZGAKWSA-N |
| XLogP | -2.02 |
| TPSA | 156.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|