C16H28N6O8 — CID 174847898
bis[(2R)-2-amino-5-(carbamoylamino)pentanoyl] butanedioate (PubChem CID 174847898) has the molecular formula C16H28N6O8 and a molecular weight of 432.43 g/mol. Its IUPAC name is bis[(2R)-2-amino-5-(carbamoylamino)pentanoyl] butanedioate.
| Compound Name | bis[(2R)-2-amino-5-(carbamoylamino)pentanoyl] butanedioate |
|---|---|
| PubChem CID | 174847898 |
| Molecular Formula | C16H28N6O8 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | bis[(2R)-2-amino-5-(carbamoylamino)pentanoyl] butanedioate |
| SMILES | NC(=O)NCCC[C@@H](N)C(=O)OC(=O)CCC(=O)OC(=O)[C@H](N)CCCNC(N)=O |
| InChI | InChI=1S/C16H28N6O8/c17-9(3-1-7-21-15(19)27)13(25)29-11(23)5-6-12(24)30-14(26)10(18)4-2-8-22-16(20)28/h9-10H,1-8,17-18H2,(H3,19,21,27)(H3,20,22,28)/t9-,10-/m1/s1 |
| InChIKey | FBKZQSZYYHRKFK-NXEZZACHSA-N |
| XLogP | -2.54 |
| TPSA | 249.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|