C17H28N6O9 — CID 174597733
bis[(2S)-2-amino-5-(carbamoylamino)pentanoyl] 2-oxopentanedioate (PubChem CID 174597733) has the molecular formula C17H28N6O9 and a molecular weight of 460.44 g/mol. Its IUPAC name is bis[(2S)-2-amino-5-(carbamoylamino)pentanoyl] 2-oxopentanedioate.
| Compound Name | bis[(2S)-2-amino-5-(carbamoylamino)pentanoyl] 2-oxopentanedioate |
|---|---|
| PubChem CID | 174597733 |
| Molecular Formula | C17H28N6O9 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | bis[(2S)-2-amino-5-(carbamoylamino)pentanoyl] 2-oxopentanedioate |
| SMILES | NC(=O)NCCC[C@H](N)C(=O)OC(=O)CCC(=O)C(=O)OC(=O)[C@@H](N)CCCNC(N)=O |
| InChI | InChI=1S/C17H28N6O9/c18-9(3-1-7-22-16(20)29)13(26)31-12(25)6-5-11(24)15(28)32-14(27)10(19)4-2-8-23-17(21)30/h9-10H,1-8,18-19H2,(H3,20,22,29)(H3,21,23,30)/t9-,10-/m0/s1 |
| InChIKey | UZAKDZYRMATKSL-UWVGGRQHSA-N |
| XLogP | -2.97 |
| TPSA | 266.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|