C6H14N3O6P — CID 175024515
phosphono (2S)-2-amino-5-(carbamoylamino)pentanoate (PubChem CID 175024515) has the molecular formula C6H14N3O6P and a molecular weight of 255.17 g/mol. Its IUPAC name is phosphono (2S)-2-amino-5-(carbamoylamino)pentanoate.
| Compound Name | phosphono (2S)-2-amino-5-(carbamoylamino)pentanoate |
|---|---|
| PubChem CID | 175024515 |
| Molecular Formula | C6H14N3O6P |
| Molecular Weight | 255.17 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | phosphono (2S)-2-amino-5-(carbamoylamino)pentanoate |
| SMILES | NC(=O)NCCC[C@H](N)C(=O)OP(=O)(O)O |
| InChI | InChI=1S/C6H14N3O6P/c7-4(2-1-3-9-6(8)11)5(10)15-16(12,13)14/h4H,1-3,7H2,(H3,8,9,11)(H2,12,13,14)/t4-/m0/s1 |
| InChIKey | RMWVJLSUBUPXPU-BYPYZUCNSA-N |
| XLogP | -1.60 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.17 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|