C9H21N3O2 — CID 145237808
(4-amino-5-oxohexyl)urea;ethane (PubChem CID 145237808) has the molecular formula C9H21N3O2 and a molecular weight of 203.29 g/mol. Its IUPAC name is (4-amino-5-oxohexyl)urea;ethane.
| Compound Name | (4-amino-5-oxohexyl)urea;ethane |
|---|---|
| PubChem CID | 145237808 |
| Molecular Formula | C9H21N3O2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.16 |
| IUPAC Name | (4-amino-5-oxohexyl)urea;ethane |
| SMILES | CC.CC(=O)C(N)CCCNC(N)=O |
| InChI | InChI=1S/C7H15N3O2.C2H6/c1-5(11)6(8)3-2-4-10-7(9)12;1-2/h6H,2-4,8H2,1H3,(H3,9,10,12);1-2H3 |
| InChIKey | VRAJUPLIAUUXJM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|