C8H17N5O3 — CID 18609889
(2S)-2-amino-N-(2-amino-2-oxoethyl)-5-(carbamoylamino)pentanamide (PubChem CID 18609889) has the molecular formula C8H17N5O3 and a molecular weight of 231.26 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-amino-2-oxoethyl)-5-(carbamoylamino)pentanamide.
| Compound Name | (2S)-2-amino-N-(2-amino-2-oxoethyl)-5-(carbamoylamino)pentanamide |
|---|---|
| PubChem CID | 18609889 |
| Molecular Formula | C8H17N5O3 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (2S)-2-amino-N-(2-amino-2-oxoethyl)-5-(carbamoylamino)pentanamide |
| SMILES | NC(=O)CNC(=O)[C@@H](N)CCCNC(N)=O |
| InChI | InChI=1S/C8H17N5O3/c9-5(2-1-3-12-8(11)16)7(15)13-4-6(10)14/h5H,1-4,9H2,(H2,10,14)(H,13,15)(H3,11,12,16)/t5-/m0/s1 |
| InChIKey | JAXIEUYYQDJWQC-YFKPBYRVSA-N |
| XLogP | -2.64 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|