C6H14N4O2 — CID 129140717
(2R)-2-amino-5-(carbamoylamino)pentanamide (PubChem CID 129140717) has the molecular formula C6H14N4O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is (2R)-2-amino-5-(carbamoylamino)pentanamide.
| Compound Name | (2R)-2-amino-5-(carbamoylamino)pentanamide |
|---|---|
| PubChem CID | 129140717 |
| Molecular Formula | C6H14N4O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | (2R)-2-amino-5-(carbamoylamino)pentanamide |
| SMILES | NC(=O)NCCC[C@@H](N)C(N)=O |
| InChI | InChI=1S/C6H14N4O2/c7-4(5(8)11)2-1-3-10-6(9)12/h4H,1-3,7H2,(H2,8,11)(H3,9,10,12)/t4-/m1/s1 |
| InChIKey | GFAXSDSHYATBAW-SCSAIBSYSA-N |
| XLogP | -1.75 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|