C12H25KN6O5 — CID 174823940
potassium;[(2S)-2-amino-5-(carbamoylamino)pentanoyl] (2S)-2-amino-5-(carbamoylamino)pentanoate;hydride (PubChem CID 174823940) has the molecular formula C12H25KN6O5 and a molecular weight of 372.47 g/mol. Its IUPAC name is potassium;[(2S)-2-amino-5-(carbamoylamino)pentanoyl] (2S)-2-amino-5-(carbamoylamino)pentanoate;hydride.
| Compound Name | potassium;[(2S)-2-amino-5-(carbamoylamino)pentanoyl] (2S)-2-amino-5-(carbamoylamino)pentanoate;hydride |
|---|---|
| PubChem CID | 174823940 |
| Molecular Formula | C12H25KN6O5 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | potassium;[(2S)-2-amino-5-(carbamoylamino)pentanoyl] (2S)-2-amino-5-(carbamoylamino)pentanoate;hydride |
| SMILES | NC(=O)NCCC[C@H](N)C(=O)OC(=O)[C@@H](N)CCCNC(N)=O.[H-].[K+] |
| InChI | InChI=1S/C12H24N6O5.K.H/c13-7(3-1-5-17-11(15)21)9(19)23-10(20)8(14)4-2-6-18-12(16)22;;/h7-8H,1-6,13-14H2,(H3,15,17,21)(H3,16,18,22);;/q;+1;-1/t7-,8-;;/m0../s1 |
| InChIKey | CISPOJNCRDMLOZ-FOMWZSOGSA-N |
| XLogP | -5.28 |
| TPSA | 205.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | -5.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|