C16H30N6O6 — CID 156701152
[(2S)-2-amino-5-(carbamoylamino)pentanoyl] (2S,3S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methylpentanoate (PubChem CID 156701152) has the molecular formula C16H30N6O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is [(2S)-2-amino-5-(carbamoylamino)pentanoyl] (2S,3S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methylpentanoate.
| Compound Name | [(2S)-2-amino-5-(carbamoylamino)pentanoyl] (2S,3S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 156701152 |
| Molecular Formula | C16H30N6O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | [(2S)-2-amino-5-(carbamoylamino)pentanoyl] (2S,3S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)CNC(=O)CN)C(=O)OC(=O)[C@@H](N)CCCNC(N)=O |
| InChI | InChI=1S/C16H30N6O6/c1-3-9(2)13(22-12(24)8-21-11(23)7-17)15(26)28-14(25)10(18)5-4-6-20-16(19)27/h9-10,13H,3-8,17-18H2,1-2H3,(H,21,23)(H,22,24)(H3,19,20,27)/t9-,10-,13-/m0/s1 |
| InChIKey | YZHPLGFQMAUMCG-KWBADKCTSA-N |
| XLogP | -2.56 |
| TPSA | 208.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|