C19H32N4O8 — CID 123467856
bis[(2S)-2,6-diaminohexanoyl] 3,4-dioxoheptanedioate (PubChem CID 123467856) has the molecular formula C19H32N4O8 and a molecular weight of 444.49 g/mol. Its IUPAC name is bis[(2S)-2,6-diaminohexanoyl] 3,4-dioxoheptanedioate.
| Compound Name | bis[(2S)-2,6-diaminohexanoyl] 3,4-dioxoheptanedioate |
|---|---|
| PubChem CID | 123467856 |
| Molecular Formula | C19H32N4O8 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | bis[(2S)-2,6-diaminohexanoyl] 3,4-dioxoheptanedioate |
| SMILES | NCCCC[C@H](N)C(=O)OC(=O)CCC(=O)C(=O)CC(=O)OC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C19H32N4O8/c20-9-3-1-5-12(22)18(28)30-16(26)8-7-14(24)15(25)11-17(27)31-19(29)13(23)6-2-4-10-21/h12-13H,1-11,20-23H2/t12-,13-/m0/s1 |
| InChIKey | NIDNFELBOVQBSD-STQMWFEESA-N |
| XLogP | -1.65 |
| TPSA | 224.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|