C13H28N4Na2O5 — CID 174505551
disodium;[(2S)-2,6-diaminohexanoyl]oxycarbonyl (2S)-2,6-diaminohexanoate;hydride (PubChem CID 174505551) has the molecular formula C13H28N4Na2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is disodium;[(2S)-2,6-diaminohexanoyl]oxycarbonyl (2S)-2,6-diaminohexanoate;hydride.
| Compound Name | disodium;[(2S)-2,6-diaminohexanoyl]oxycarbonyl (2S)-2,6-diaminohexanoate;hydride |
|---|---|
| PubChem CID | 174505551 |
| Molecular Formula | C13H28N4Na2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | disodium;[(2S)-2,6-diaminohexanoyl]oxycarbonyl (2S)-2,6-diaminohexanoate;hydride |
| SMILES | NCCCC[C@H](N)C(=O)OC(=O)OC(=O)[C@@H](N)CCCCN.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C13H26N4O5.2Na.2H/c14-7-3-1-5-9(16)11(18)21-13(20)22-12(19)10(17)6-2-4-8-15;;;;/h9-10H,1-8,14-17H2;;;;/q;2*+1;2*-1/t9-,10-;;;;/m0..../s1 |
| InChIKey | NYEULVGIIHJGAV-IJBXMQGASA-N |
| XLogP | -6.66 |
| TPSA | 173.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | -6.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|