C14H29ClN4O5 — CID 174780244
[2-[(2S)-2,6-diaminohexanoyl]oxy-2-oxoethyl] (2S)-2,6-diaminohexanoate;hydrochloride (PubChem CID 174780244) has the molecular formula C14H29ClN4O5 and a molecular weight of 368.86 g/mol. Its IUPAC name is [2-[(2S)-2,6-diaminohexanoyl]oxy-2-oxoethyl] (2S)-2,6-diaminohexanoate;hydrochloride.
| Compound Name | [2-[(2S)-2,6-diaminohexanoyl]oxy-2-oxoethyl] (2S)-2,6-diaminohexanoate;hydrochloride |
|---|---|
| PubChem CID | 174780244 |
| Molecular Formula | C14H29ClN4O5 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [2-[(2S)-2,6-diaminohexanoyl]oxy-2-oxoethyl] (2S)-2,6-diaminohexanoate;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)C(=O)OCC(=O)OC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C14H28N4O5.ClH/c15-7-3-1-5-10(17)13(20)22-9-12(19)23-14(21)11(18)6-2-4-8-16;/h10-11H,1-9,15-18H2;1H/t10-,11-;/m0./s1 |
| InChIKey | JFPVOOYKQSMXTA-ACMTZBLWSA-N |
| XLogP | -1.07 |
| TPSA | 173.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|