C8H17N2O7P — CID 174743807
(2-phosphonooxyacetyl) (2S)-2,6-diaminohexanoate (PubChem CID 174743807) has the molecular formula C8H17N2O7P and a molecular weight of 284.20 g/mol. Its IUPAC name is (2-phosphonooxyacetyl) (2S)-2,6-diaminohexanoate.
| Compound Name | (2-phosphonooxyacetyl) (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 174743807 |
| Molecular Formula | C8H17N2O7P |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (2-phosphonooxyacetyl) (2S)-2,6-diaminohexanoate |
| SMILES | NCCCC[C@H](N)C(=O)OC(=O)COP(=O)(O)O |
| InChI | InChI=1S/C8H17N2O7P/c9-4-2-1-3-6(10)8(12)17-7(11)5-16-18(13,14)15/h6H,1-5,9-10H2,(H2,13,14,15)/t6-/m0/s1 |
| InChIKey | VHAJTTFOJPZOCD-LURJTMIESA-N |
| XLogP | -1.38 |
| TPSA | 162.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|