C29H32N4O3S — CID 3625791
1-(2,4-dimethoxyphenyl)-3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]urea (PubChem CID 3625791) has the molecular formula C29H32N4O3S and a molecular weight of 516.67 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]urea |
|---|---|
| PubChem CID | 3625791 |
| Molecular Formula | C29H32N4O3S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[2-(4,5-diphenyl-1-propylimidazol-2-yl)sulfanylethyl]urea |
| SMILES | CCCn1c(SCCNC(=O)Nc2ccc(OC)cc2OC)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C29H32N4O3S/c1-4-18-33-27(22-13-9-6-10-14-22)26(21-11-7-5-8-12-21)32-29(33)37-19-17-30-28(34)31-24-16-15-23(35-2)20-25(24)36-3/h5-16,20H,4,17-19H2,1-3H3,(H2,30,31,34) |
| InChIKey | BEHXNGIATQYQND-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|