C30H33N3O3S — CID 3892183
N-[4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]-3,5-dimethoxybenzamide (PubChem CID 3892183) has the molecular formula C30H33N3O3S and a molecular weight of 515.68 g/mol. Its IUPAC name is N-[4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 3892183 |
| Molecular Formula | C30H33N3O3S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | N-[4-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylbutyl]-3,5-dimethoxybenzamide |
| SMILES | CCn1c(SCCCCNC(=O)c2cc(OC)cc(OC)c2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C30H33N3O3S/c1-4-33-28(23-15-9-6-10-16-23)27(22-13-7-5-8-14-22)32-30(33)37-18-12-11-17-31-29(34)24-19-25(35-2)21-26(20-24)36-3/h5-10,13-16,19-21H,4,11-12,17-18H2,1-3H3,(H,31,34) |
| InChIKey | QORIDPKGSHWBBO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|