C36H42N4OS — CID 5237484
5-(4,5-diphenyl-1-propan-2-ylimidazol-2-yl)sulfanyl-1-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pentan-1-one (PubChem CID 5237484) has the molecular formula C36H42N4OS and a molecular weight of 578.83 g/mol. Its IUPAC name is 5-(4,5-diphenyl-1-propan-2-ylimidazol-2-yl)sulfanyl-1-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 5-(4,5-diphenyl-1-propan-2-ylimidazol-2-yl)sulfanyl-1-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 5237484 |
| Molecular Formula | C36H42N4OS |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | 5-(4,5-diphenyl-1-propan-2-ylimidazol-2-yl)sulfanyl-1-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pentan-1-one |
| SMILES | CC(C)n1c(SCCCCC(=O)N2CCN(CC=Cc3ccccc3)CC2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C36H42N4OS/c1-29(2)40-35(32-20-10-5-11-21-32)34(31-18-8-4-9-19-31)37-36(40)42-28-13-12-22-33(41)39-26-24-38(25-27-39)23-14-17-30-15-6-3-7-16-30/h3-11,14-21,29H,12-13,22-28H2,1-2H3 |
| InChIKey | JIVQKSOZPXIXIE-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|