C12H17N3OS — CID 78812877
3-butylsulfanyl-4-ethyl-5-(furan-2-yl)-1,2,4-triazole (PubChem CID 78812877) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-butylsulfanyl-4-ethyl-5-(furan-2-yl)-1,2,4-triazole.
| Compound Name | 3-butylsulfanyl-4-ethyl-5-(furan-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 78812877 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 3-butylsulfanyl-4-ethyl-5-(furan-2-yl)-1,2,4-triazole |
| SMILES | CCCCSc1nnc(-c2ccco2)n1CC |
| InChI | InChI=1S/C12H17N3OS/c1-3-5-9-17-12-14-13-11(15(12)4-2)10-7-6-8-16-10/h6-8H,3-5,9H2,1-2H3 |
| InChIKey | FBKGHSNYASGNCB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|