C19H23N3O2S — CID 55390447
3-[3-(3,5-dimethylphenoxy)propylsulfanyl]-4-ethyl-5-(furan-2-yl)-1,2,4-triazole (PubChem CID 55390447) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylphenoxy)propylsulfanyl]-4-ethyl-5-(furan-2-yl)-1,2,4-triazole.
| Compound Name | 3-[3-(3,5-dimethylphenoxy)propylsulfanyl]-4-ethyl-5-(furan-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 55390447 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-[3-(3,5-dimethylphenoxy)propylsulfanyl]-4-ethyl-5-(furan-2-yl)-1,2,4-triazole |
| SMILES | CCn1c(SCCCOc2cc(C)cc(C)c2)nnc1-c1ccco1 |
| InChI | InChI=1S/C19H23N3O2S/c1-4-22-18(17-7-5-8-24-17)20-21-19(22)25-10-6-9-23-16-12-14(2)11-15(3)13-16/h5,7-8,11-13H,4,6,9-10H2,1-3H3 |
| InChIKey | WBFKEQAAOVKOQC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|