C10H12ClN3OS — CID 91755704
3-(3-chloropropylsulfanyl)-5-(furan-2-yl)-4-methyl-1,2,4-triazole (PubChem CID 91755704) has the molecular formula C10H12ClN3OS and a molecular weight of 257.75 g/mol. Its IUPAC name is 3-(3-chloropropylsulfanyl)-5-(furan-2-yl)-4-methyl-1,2,4-triazole.
| Compound Name | 3-(3-chloropropylsulfanyl)-5-(furan-2-yl)-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 91755704 |
| Molecular Formula | C10H12ClN3OS |
| Molecular Weight | 257.75 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 3-(3-chloropropylsulfanyl)-5-(furan-2-yl)-4-methyl-1,2,4-triazole |
| SMILES | Cn1c(SCCCCl)nnc1-c1ccco1 |
| InChI | InChI=1S/C10H12ClN3OS/c1-14-9(8-4-2-6-15-8)12-13-10(14)16-7-3-5-11/h2,4,6H,3,5,7H2,1H3 |
| InChIKey | BZXRGOZBCYBXSG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|