C10H12ClN5S — CID 44627895
5-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]pyrimidine (PubChem CID 44627895) has the molecular formula C10H12ClN5S and a molecular weight of 269.76 g/mol. Its IUPAC name is 5-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]pyrimidine.
| Compound Name | 5-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]pyrimidine |
|---|---|
| PubChem CID | 44627895 |
| Molecular Formula | C10H12ClN5S |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 5-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]pyrimidine |
| SMILES | Cn1c(SCCCCl)nnc1-c1cncnc1 |
| InChI | InChI=1S/C10H12ClN5S/c1-16-9(8-5-12-7-13-6-8)14-15-10(16)17-4-2-3-11/h5-7H,2-4H2,1H3 |
| InChIKey | FNTWRQCMIYISIX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|