C11H14ClN5S — CID 121304692
2-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]-3-methylpyrazine (PubChem CID 121304692) has the molecular formula C11H14ClN5S and a molecular weight of 283.79 g/mol. Its IUPAC name is 2-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]-3-methylpyrazine.
| Compound Name | 2-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]-3-methylpyrazine |
|---|---|
| PubChem CID | 121304692 |
| Molecular Formula | C11H14ClN5S |
| Molecular Weight | 283.79 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]-3-methylpyrazine |
| SMILES | Cc1nccnc1-c1nnc(SCCCCl)n1C |
| InChI | InChI=1S/C11H14ClN5S/c1-8-9(14-6-5-13-8)10-15-16-11(17(10)2)18-7-3-4-12/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | YNCPACQBFRXYCL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|