C11H13ClN4S — CID 53417310
3-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]pyridine (PubChem CID 53417310) has the molecular formula C11H13ClN4S and a molecular weight of 268.77 g/mol. Its IUPAC name is 3-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 3-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 53417310 |
| Molecular Formula | C11H13ClN4S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]pyridine |
| SMILES | Cn1c(SCCCCl)nnc1-c1cccnc1 |
| InChI | InChI=1S/C11H13ClN4S/c1-16-10(9-4-2-6-13-8-9)14-15-11(16)17-7-3-5-12/h2,4,6,8H,3,5,7H2,1H3 |
| InChIKey | OZLMWITUNBVEPK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|