C12H15ClN4OS — CID 121304625
4-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]-1-methylpyridin-2-one (PubChem CID 121304625) has the molecular formula C12H15ClN4OS and a molecular weight of 298.80 g/mol. Its IUPAC name is 4-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]-1-methylpyridin-2-one.
| Compound Name | 4-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 121304625 |
| Molecular Formula | C12H15ClN4OS |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 4-[5-(3-chloropropylsulfanyl)-4-methyl-1,2,4-triazol-3-yl]-1-methylpyridin-2-one |
| SMILES | Cn1c(SCCCCl)nnc1-c1ccn(C)c(=O)c1 |
| InChI | InChI=1S/C12H15ClN4OS/c1-16-6-4-9(8-10(16)18)11-14-15-12(17(11)2)19-7-3-5-13/h4,6,8H,3,5,7H2,1-2H3 |
| InChIKey | BRSAYQMINJJVBB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|