C24H29FN6OS — CID 126534441
4-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1-methylpyridin-2-one (PubChem CID 126534441) has the molecular formula C24H29FN6OS and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1-methylpyridin-2-one.
| Compound Name | 4-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 126534441 |
| Molecular Formula | C24H29FN6OS |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 4-[5-[3-[1-(4-fluorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1-methylpyridin-2-one |
| SMILES | Cn1c(SCCCN2CC3CCN(c4ccc(F)cc4)C3C2)nnc1-c1ccn(C)c(=O)c1 |
| InChI | InChI=1S/C24H29FN6OS/c1-28-11-8-17(14-22(28)32)23-26-27-24(29(23)2)33-13-3-10-30-15-18-9-12-31(21(18)16-30)20-6-4-19(25)5-7-20/h4-8,11,14,18,21H,3,9-10,12-13,15-16H2,1-2H3 |
| InChIKey | XRJAGLUSGLFLQK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|